A3278812
3,5-Dibromobenzaldehyde , 98% , 56990-02-4
CAS NO.：56990-02-4
Empirical Formula: C7H4Br2O
Molecular Weight: 263.91
MDL number: MFCD00156887
EINECS: 611-441-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB82.40 | In Stock |
|
| 25G | RMB340.80 | In Stock |
|
| 100G | RMB1063.20 | In Stock |
|
| 500g | RMB4559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 84-88 °C (lit.) |
| Boiling point: | 287.2±20.0 °C(Predicted) |
| Density | 1.977±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in DMSO, Ethyl Acetate, Methanol |
| form | Powder or Crystals |
| color | White to light beige |
| Water Solubility | insoluble |
| Sensitive | Air Sensitive |
| BRN | 2573432 |
| InChI | InChI=1S/C7H4Br2O/c8-6-1-5(4-10)2-7(9)3-6/h1-4H |
| InChIKey | ZLDMZIXUGCGKMB-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(Br)=CC(Br)=C1 |
Description and Uses
3,5-Dibromobenzaldehyde is a dibrominated benzaldehyde that is a very useful building block for the preparation of a wide range of biologically active compounds such as a antibacterials
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | Ⅱ |
| HS Code | 29130000 |
