A3266512
2,6-Difluorotoluene , 99% , 443-84-5
CAS NO.：443-84-5
Empirical Formula: C7H6F2
Molecular Weight: 128.12
MDL number: MFCD00043898
EINECS: 623-587-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB127.20 | In Stock |
|
| 25G | RMB431.20 | In Stock |
|
| 100G | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 112 °C/740 mmHg (lit.) |
| Density | 1.129 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 50 °F |
| storage temp. | Sealed in dry,2-8°C |
| form | clear liquid |
| Specific Gravity | 1.129 |
| color | Colorless to Light yellow |
| BRN | 1932656 |
| InChI | InChI=1S/C7H6F2/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| InChIKey | MZLSNIREOQCDED-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(F)=C1C |
| CAS DataBase Reference | 443-84-5(CAS DataBase Reference) |
Description and Uses
2,6-Difluorotoluene was used to generate jet-cooled 2,6-difluorobenzyl radical and to investigate its vibronically resolved emission spectra.
