A3266312
(-)-Dipivaloyl-L-tartaric Acid , 98% , 65259-81-6
Synonym(s):
(−)-DPTA
| Pack Size | Price | Stock | Quantity |
| 1G | RMB90.40 | In Stock |
|
| 5G | RMB322.40 | In Stock |
|
| 25G | RMB1097.60 | In Stock |
|
| 100g | RMB3425.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 127-132 °C |
| Boiling point: | 436.6±45.0 °C(Predicted) |
| Density | 1.240±0.06 g/cm3(Predicted) |
| refractive index | -24 ° (C=2, Dioxane) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 1.68±0.25(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]20/D 23.5±1°, c = 1.7% in dioxane |
| Sensitive | Hygroscopic |
| BRN | 2008171 |
| InChI | InChI=1S/C14H22O8/c1-13(2,3)11(19)21-7(9(15)16)8(10(17)18)22-12(20)14(4,5)6/h7-8H,1-6H3,(H,15,16)(H,17,18)/t7-,8-/m1/s1 |
| InChIKey | UFHJEZDFEHUYCR-HTQZYQBOSA-N |
| SMILES | C(O)(=O)[C@H](OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)C(O)=O |
| CAS DataBase Reference | 65259-81-6(CAS DataBase Reference) |
Description and Uses
(?)-O,O′-Di-pivaloyl-L-tartaric acid can be used:
- As a chiral staple in the synthesis of helical π-conjugated cyclic nanocoils, which are used as nano springs, nano solenoids, and pressure sensors.
- As an additive in the iridium-catalyzed C-H amidation reactions of arylphosphoryl compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29189900 |
