A3237012
1,4-Diaminobenzene dihydrochloride , AR,99% , 624-18-0
Synonym(s):
1,4-Benzenediamine dihydrochloride;1,4-Phenylenediamine dihydrochloride;1,4-Phenylenediammonium dichloride
CAS NO.：624-18-0
Empirical Formula: C6H10Cl2N2
Molecular Weight: 181.06
MDL number: MFCD00013002
EINECS: 210-834-9
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >200°C |
| storage temp. | Store below +30°C. |
| solubility | Methanol (Slightly), Water (Slightly) |
| Colour Index | 76061 |
| form | Crystalline Powder |
| color | White to purple-gray |
| Water Solubility | >=10 g/100 mL at 21 ºC |
| Merck | 14,7285 |
| BRN | 3911749 |
| Stability: | Stable. Incompatible with acids, strong oxidizing agents. |
| InChI | InChI=1S/C6H8N2.2ClH/c7-5-1-2-6(8)4-3-5;;/h1-4H,7-8H2;2*1H |
| InChIKey | IYXMNTLBLQNMLM-UHFFFAOYSA-N |
| SMILES | C1(N)C=CC(N)=CC=1.Cl.Cl |
| CAS DataBase Reference | 624-18-0(CAS DataBase Reference) |
| EPA Substance Registry System | 1,4-Phenylenediamine dihydrochloride (624-18-0) |
Description and Uses
Dihydrochloride salt of 1,4-Phenylenediamine (P319845). A hair dye component, paraphenylenediamine, as a contact allergen for treatment of inflammatory diseases.
Safety
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H317-H319-H410 |
| Precautionary statements | P273-P280-P301+P310+P330-P302+P352+P312-P304+P340+P311-P305+P351+P338 |
| Hazard Codes | T,N |
| Risk Statements | 23/24/25-36-43-50/53 |
| Safety Statements | 28-36/37-45-60-61-28A |
| RIDADR | UN 1673 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | ST0350000 |
| F | 8-9 |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29215119 |
| Hazardous Substances Data | 624-18-0(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 147 mg/kg |
