A3220112
2,6-Dichlorophenylacetic acid , 98% , 6575-24-2
CAS NO.：6575-24-2
Empirical Formula: C8H6Cl2O2
Molecular Weight: 205.04
MDL number: MFCD00004320
EINECS: 229-504-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB33.60 | In Stock |
|
| 25G | RMB134.40 | In Stock |
|
| 100G | RMB500.00 | In Stock |
|
| 500g | RMB2217.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158-161 °C (lit.) |
| Boiling point: | 294.45°C (rough estimate) |
| Density | 1.3806 (rough estimate) |
| refractive index | 1.5490 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 3.80±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| BRN | 1952744 |
| InChI | InChI=1S/C8H6Cl2O2/c9-6-2-1-3-7(10)5(6)4-8(11)12/h1-3H,4H2,(H,11,12) |
| InChIKey | SFAILOOQFZNOAU-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=C(Cl)C=CC=C1Cl |
Description and Uses
2,6-Dichlorophenylacetic acid is an inhibitor of isopenicillin N synthase (IPNS) and acyl-CoA: 6-APA acyltransferase. 2,6-Dichlorophenylacetic acid is also part of a group of phenylacetate derivatives that have cytostatic activity against tumour cells.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-26/37/39-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29163900 |
