A3216412
Dibenzyl azodicarboxylate , 94% , 2449-05-0
CAS NO.：2449-05-0
Empirical Formula: C16H14N2O4
Molecular Weight: 298.29
MDL number: MFCD00016737
EINECS: 219-508-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB69.60 | In Stock |
|
| 25G | RMB267.20 | In Stock |
|
| 100G | RMB807.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 43-47 °C (lit.) |
| Boiling point: | 439.72°C (rough estimate) |
| Density | 1.2028 (rough estimate) |
| refractive index | 1.6240 (estimate) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | Crystalline Powder |
| color | Yellow to orange |
| Sensitive | Light Sensitive |
| BRN | 2298734 |
| InChI | InChI=1S/C16H14N2O4/c19-15(21-11-13-7-3-1-4-8-13)17-18-16(20)22-12-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | IRJKSAIGIYODAN-ISLYRVAYSA-N |
| SMILES | N(C(OCC1=CC=CC=C1)=O)=NC(OCC1=CC=CC=C1)=O |
Description and Uses
Dibenzyl azodicarboxylate was used as electrophilic reagent in the synthesis of C-glycosyl α-amino acids via proline-catalyzed α-amination of C-glycosylalkyl aldehydes. It was used in enantioselective synthesis of optically active pyrazolidine derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,F |
| Risk Statements | 36/37/38-11 |
| Safety Statements | 26-37/39-16 |
| RIDADR | 3224 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29270000 |
