A3176412
Dimethyl 2,6-pyridinedicarboxylate , 98% , 5453-67-8
CAS NO.：5453-67-8
Empirical Formula: C9H9NO4
Molecular Weight: 195.17
MDL number: MFCD00134493
EINECS: 226-697-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB47.20 | In Stock |
|
| 10G | RMB63.20 | In Stock |
|
| 25G | RMB100.80 | In Stock |
|
| 100G | RMB388.00 | In Stock |
|
| 500g | RMB1584.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 121-125 °C(lit.) |
| Boiling point: | 100 °C(Press: 0.005 Torr) |
| Density | 1.231±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform |
| form | Solid |
| pka | -0.46±0.10(Predicted) |
| color | Off-White |
| Water Solubility | Soluble in water(14 g/L) (25°C). Soluble in chloroform. |
| InChI | InChI=1S/C9H9NO4/c1-13-8(11)6-4-3-5-7(10-6)9(12)14-2/h3-5H,1-2H3 |
| InChIKey | SNQQJEJPJMXYTR-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=NC(C(OC)=O)=CC=C1 |
Description and Uses
Dimethyl 2,6-pyridinedicarboxylate may be used in the synthesis of:
- ditopic macrocycle having two xylyl rings linked by diethylene glycol and 2,6-pyridinediamide spacers, which acts as host molecule capable of forming complexes with diphenylurea derivatives
- N,N′-bis(2-aminoethyl)dipicoloinic acid diamide Schiff base
- 1,1′-(2,6-bispyridyl)bis-3-(9-ethylcarbazole-3-yl)-1,3-propanedione
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| HS Code | 29333990 |
