![1,4-Dioxaspiro[4.5]decan-8-one](https://img.chemicalbook.com/CAS/GIF/4746-97-8.gif)
A3170212
1,4-Dioxaspiro[4.5]decan-8-one , 98% , 4746-97-8
Synonym(s):
1,4-Dioxaspiro[4.5]decan-8-one
CAS NO.：4746-97-8
Empirical Formula: C8H12O3
Molecular Weight: 156.18
MDL number: MFCD00010214
EINECS: 610-352-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB67.20 | In Stock |
|
| 100G | RMB375.20 | In Stock |
|
| 500g | RMB1758.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70-73 °C (lit.) |
| Boiling point: | 112C |
| Density | 1.0887 (rough estimate) |
| refractive index | 1.4430 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in chloroform & methanol. |
| form | Crystalline Powder or Crystals |
| color | White to beige |
| Sensitive | Moisture Sensitive |
| BRN | 117631 |
| InChI | InChI=1S/C8H12O3/c9-7-1-3-8(4-2-7)10-5-6-11-8/h1-6H2 |
| InChIKey | VKRKCBWIVLSRBJ-UHFFFAOYSA-N |
| SMILES | O1C2(CCC(=O)CC2)OCC1 |
Description and Uses
1,4-Dioxaspiro[4.5]decan-8-one is used in the preparation of series of potent analgesic compounds. 1,4-Cyclohexanedione Monoethylene Acetal is also used as a building block in the synthesis of tritium labelled probes for the autoradiography study of the dopamine reuptake complex.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36/37/39-26 |
| WGK Germany | 3 |
| F | 8-10-21 |
| Hazard Note | Irritant |
| HS Code | 29110000 |
