A2618812
3-Chloroanthranilic Acid , >98.0%(T) , 6388-47-2
Synonym(s):
3-Chloroanthranilic acid
CAS NO.：6388-47-2
Empirical Formula: C7H6ClNO2
Molecular Weight: 171.58
MDL number: MFCD00134229
EINECS: 228-996-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB37.60 | In Stock |
|
| 25G | RMB124.00 | In Stock |
|
| 100G | RMB416.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 189-191 °C (lit.) |
| Boiling point: | 0°C |
| Density | 1.476±0.06 g/cm3(Predicted) |
| Flash point: | 0°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO, Methanaol |
| form | Solid |
| pka | 4.57±0.10(Predicted) |
| color | Yellow to brown |
| Water Solubility | Soluble in water. |
| Sensitive | Air & Light Sensitive |
| InChI | InChI=1S/C7H6ClNO2/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,9H2,(H,10,11) |
| InChIKey | LWUAMROXVQLJKA-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(Cl)=C1N |
| CAS DataBase Reference | 6388-47-2(CAS DataBase Reference) |
Description and Uses
2-Amino-3-chlorobenzoic acid is used as pharmaceutical intermediates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 1 |
| Hazard Note | Irritant |
| HS Code | 29224999 |
