A2587412
2-(5-Chloro-2-benzotriazolyl)-6-<i>tert</i>-butyl-<i>p</i>-cresol , >98.0%(HPLC) , 3896-11-5
Synonym(s):
2-(2-Hydroxy-3-tert -butyl-5-methylphenyl)-5-chloro-2H -benzotriazole;2-(3-tert -Butyl-2-hydroxy-5-methylphenyl)-5-chloro-2H -benzotriazole;2-(5-Chloro-2H -benzotriazol-2-yl)-6-(1,1-dimethylethyl)-4-methylphenol;2-(5-Chloro-2-benzotriazolyl)-6-tert -butyl-p -cresol;2-[5-Chloro-2H -benzotriazol-2-yl]-4-methyl-6-(tert -butyl)phenol
CAS NO.：3896-11-5
Empirical Formula: C17H18ClN3O
Molecular Weight: 315.8
MDL number: MFCD00059707
EINECS: 223-445-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB61.60 | In Stock |
|
| 50g | RMB103.20 | In Stock |
|
| 100G | RMB157.60 | In Stock |
|
| 500G | RMB515.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 144-147 °C(lit.) |
| Boiling point: | 460.4±55.0 °C(Predicted) |
| Density | 1.26±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.31±0.48(Predicted) |
| color | Pale Yellow to Light Yellow |
| Water Solubility | 4μg/L at 20℃ |
| InChI | InChI=1S/C17H18ClN3O/c1-10-7-12(17(2,3)4)16(22)15(8-10)21-19-13-6-5-11(18)9-14(13)20-21/h5-9,22H,1-4H3 |
| InChIKey | OCWYEMOEOGEQAN-UHFFFAOYSA-N |
| SMILES | C1(O)=C(C(C)(C)C)C=C(C)C=C1N1N=C2C=C(Cl)C=CC2=N1 |
| LogP | 6.580 (est) |
Description and Uses
Bumetrizole is an intermediate reactant in the synthesis of UV light absorbers for polyester fibers.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-53 |
| Safety Statements | 26-36-61 |
| WGK Germany | 1 |
| HS Code | 29339900 |
