A2522712
1,3-Cyclopentanedione , ≥98% , 3859-41-4
CAS NO.：3859-41-4
Empirical Formula: C5H6O2
Molecular Weight: 98.1
MDL number: MFCD00001405
EINECS: 223-372-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB68.80 | In Stock |
|
| 5G | RMB194.40 | In Stock |
|
| 25G | RMB629.60 | In Stock |
|
| 100g | RMB1572.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 149-151 °C (lit.) |
| Boiling point: | 143.59°C (rough estimate) |
| Density | 1.1008 (rough estimate) |
| refractive index | 1.4400 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO, Ethyl Acetate |
| form | Crystalline Powder |
| pka | 8.94±0.20(Predicted) |
| color | white to brown |
| Water Solubility | Very soluble in water. |
| BRN | 1362728 |
| InChI | InChI=1S/C5H6O2/c6-4-1-2-5(7)3-4/h1-3H2 |
| InChIKey | LOGSONSNCYTHPS-UHFFFAOYSA-N |
| SMILES | C1(=O)CCC(=O)C1 |
Description and Uses
1,3-Cyclopentanedione was used in the synthesis of chemical probes for selective labeling of sulfenic acid proteins. It was also used to synthesize enaminones with possible anticonvulsant activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29142900 |
