A2488712
2-chloroquinoxaline , 97% , 1448-87-9
CAS NO.：1448-87-9
Empirical Formula: C8H5ClN2
Molecular Weight: 164.59
MDL number: MFCD00043907
EINECS: 215-905-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB24.00 | In Stock |
|
| 1G | RMB34.40 | In Stock |
|
| 5G | RMB83.20 | In Stock |
|
| 25G | RMB353.60 | In Stock |
|
| 100g | RMB1288.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 47-50 °C (lit.) |
| Boiling point: | 100 °C/1.4 mmHg (lit.) |
| Density | 1.2847 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| form | Crystalline Powder |
| pka | -1.21±0.30(Predicted) |
| color | White to gray |
| InChI | InChI=1S/C8H5ClN2/c9-8-5-10-6-3-1-2-4-7(6)11-8/h1-5H |
| InChIKey | BYHVGQHIAFURIL-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)N=CC=1Cl |
Description and Uses
2-Chloroquinoxaline (QCI) was used to study the effect of solvent on hydrolysis of QCI in aqueous–organic solvent mixtures with acetonitrile and dimethylesulphoxide. It was used in the synthesis of 2-(3-butynyl-2-methyl-2-ol) quinoxaline.It was used as reagent in the synthesis of chloroquinoxaline sulfamide.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | T,Xn |
| Risk Statements | 25-36/37/38-22 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
