A2477212
(±)-Camphorquinone , >98.0%(GC) , 10373-78-1
CAS NO.：10373-78-1
Empirical Formula: C10H14O2
Molecular Weight: 166.22
MDL number: MFCD00064160
EINECS: 233-814-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB109.60 | In Stock |
|
| 25G | RMB392.80 | In Stock |
|
| 100G | RMB1440.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 197-203 °C (lit.) |
| Boiling point: | 234.44°C (rough estimate) |
| alpha | -5～+5°(20℃/D)(c=2, CHCl3) |
| Density | 0.9817 (rough estimate) |
| refractive index | 1.4859 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | Soluble in ethanol, ethyl ether and benzene. |
| form | Fine Crystalline Powder |
| color | Yellow |
| BRN | 1909463 |
| InChI | InChI=1S/C10H14O2/c1-9(2)6-4-5-10(9,3)8(12)7(6)11/h6H,4-5H2,1-3H3 |
| InChIKey | VNQXSTWCDUXYEZ-UHFFFAOYSA-N |
| SMILES | C12(C)C(C)(C)C(CC1)C(=O)C2=O |
| LogP | 1.470 (est) |
Description and Uses
CQ-amines are used as a photo initiators for free radical polymerization. CQ was used as an initiator in the preparation of silver nanoparticle/silica/ polymer nanocomposites. Photopolymerization kinetics of dimethacrylates were studied using the CQ/amine initiator system.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 2914 29 00 |
