A2456012
6-Chlorooxindole , ≥98.0% , 56341-37-8
Synonym(s):
6-Chloro-1,3-dihydroindol-2-one;6-Chlorooxindole
CAS NO.：56341-37-8
Empirical Formula: C8H6ClNO
Molecular Weight: 167.59
MDL number: MFCD00209962
EINECS: 1312995-182-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB48.00 | In Stock |
|
| 25G | RMB126.40 | In Stock |
|
| 100G | RMB506.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 195-199 °C (lit.) |
| Boiling point: | 329.0±42.0 °C(Predicted) |
| Density | 1.362±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Dimethylformamide |
| form | powder to crystal |
| pka | 13.39±0.20(Predicted) |
| color | Light yellow to Brown |
| InChI | InChI=1S/C8H6ClNO/c9-6-2-1-5-3-8(11)10-7(5)4-6/h1-2,4H,3H2,(H,10,11) |
| InChIKey | CENVPIZOTHULGJ-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC(Cl)=C2)CC1=O |
Description and Uses
6-Chlorooxindole is a useful research chemical used in the design of potent non-peptide MDM2 inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P280-P301+P312+P330-P302+P352 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-43-36/37/38 |
| Safety Statements | 37/39-36-26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29337900 |
