A2454012
2-Chloro-4-nitrobenzoic acid , 98% , 99-60-5
CAS NO.：99-60-5
Empirical Formula: C7H4ClNO4
Molecular Weight: 201.56
MDL number: MFCD00007209
EINECS: 202-771-0
| Pack Size | Price | Stock | Quantity |
| 25G | RMB39.20 | In Stock |
|
| 100G | RMB127.20 | In Stock |
|
| 500G | RMB566.40 | In Stock |
|
| 2.5KG | RMB2799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-140 °C(lit.) |
| Boiling point: | 160.5°C (rough estimate) |
| Density | 1.5719 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | pK1: 1.96 (25°C) |
| form | Crystalline Powder |
| color | Light yellow to light green |
| Water Solubility | 1 g/L (20 ºC) |
| BRN | 1912836 |
| InChI | InChI=1S/C7H4ClNO4/c8-6-3-4(9(12)13)1-2-5(6)7(10)11/h1-3H,(H,10,11) |
| InChIKey | QAYNSPOKTRVZRC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C([N+]([O-])=O)C=C1Cl |
| CAS DataBase Reference | 99-60-5(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 2-chloro-4-nitro- (99-60-5) |
Description and Uses
The active pharmaceutical ingredient 2-chloro-4-nitrobenzoic acid (2c4n) is a potentially novel therapy for immunodeficiency diseases as an anti-viral and anti-cancer agent and is a dimorph in the solid state. 2c4n is a historically significant compound from a polymorphic point of view, as it was one of the samples used by Ebert and Gottlieb to show that polymorphs can be identified or differentiated through their IR spectra back in 1952[1].
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335-H319 |
| Precautionary statements | P264-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280a-P337+P313-P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41-37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | DG5425000 |
| TSCA | Yes |
| HS Code | 29163900 |
