A2446912
3-Cyclopropyl-3-oxopropionic Acid Methyl Ester , >96.0%(GC) , 32249-35-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB53.60 | In Stock |
|
| 100G | RMB198.40 | In Stock |
|
| 500G | RMB863.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 193°C |
| Density | 1.174 |
| refractive index | 1.4500 to 1.4540 |
| Flash point: | 74°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform |
| form | Oil |
| pka | 10.59±0.20(Predicted) |
| color | Clear Colorless |
| InChI | InChI=1S/C7H10O3/c1-10-7(9)4-6(8)5-2-3-5/h5H,2-4H2,1H3 |
| InChIKey | RIJWDPRXCXJDPK-UHFFFAOYSA-N |
| SMILES | C1(CC1)C(=O)CC(=O)OC |
| CAS DataBase Reference | 32249-35-7(CAS DataBase Reference) |
Description and Uses
Methyl 3-cyclopropyl-3-oxopropionate is a reagent used in the synthesis of Pitavastatin.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2918300090 |
