A2441612
3-Chloro-2-methylbenzoic acid , 98% , 7499-08-3
CAS NO.：7499-08-3
Empirical Formula: C8H7ClO2
Molecular Weight: 170.59
MDL number: MFCD00053312
EINECS: 626-731-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB97.60 | In Stock |
|
| 100G | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 163-166 °C (lit.) |
| Boiling point: | 290.9±20.0 °C(Predicted) |
| Density | 1.310±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.58±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 1072826 |
| InChI | InChI=1S/C8H7ClO2/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4H,1H3,(H,10,11) |
| InChIKey | HXGHMCLCSPQMOR-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(Cl)=C1C |
| CAS DataBase Reference | 7499-08-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | XU1645000 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
