A2440812
2-Chloro-6-methoxy-3-nitropyridine , >98.0%(GC) , 38533-61-8
CAS NO.：38533-61-8
Empirical Formula: C6H5ClN2O3
Molecular Weight: 188.57
MDL number: MFCD00130268
EINECS: 253-989-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB40.00 | In Stock |
|
| 25G | RMB122.40 | In Stock |
|
| 100G | RMB348.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78-80 °C (lit.) |
| Boiling point: | 298.5±35.0 °C(Predicted) |
| Density | 1.445±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | -2.34±0.10(Predicted) |
| form | Powder |
| color | Off-white to yellow |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C6H5ClN2O3/c1-12-5-3-2-4(9(10)11)6(7)8-5/h2-3H,1H3 |
| InChIKey | DVRGUTNVDGIKTP-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(OC)=CC=C1[N+]([O-])=O |
Description and Uses
6-methoxy-3-nitropyridine-2-carbonitrile was synthesised from 2-Chloro-6-methoxy-3-nitropyridine. Reatant in the suzuki and negishi couplings reaction. Also as fine chemical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-44-20/21/22 |
| Safety Statements | 26-37/39-36/37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| HS Code | 29333990 |
