A2440712
6-Chloro-3-pyridinecarbonitrile , 98% , 33252-28-7
Synonym(s):
2-Chloro-5-cyanopyridine;2-Chloropyridine-5-carbonitrile
CAS NO.：33252-28-7
Empirical Formula: C6H3ClN2
Molecular Weight: 138.55
MDL number: MFCD00084941
EINECS: 608-851-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB62.40 | In Stock |
|
| 25G | RMB223.20 | In Stock |
|
| 100G | RMB766.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116-120 °C(lit.) |
| Boiling point: | 105-107°C 1mm |
| Density | 1.33±0.1 g/cm3(Predicted) |
| Flash point: | 105-107°C/1mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Ethanol |
| pka | -3.56±0.10(Predicted) |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| BRN | 113867 |
| InChI | InChI=1S/C6H3ClN2/c7-6-2-1-5(3-8)4-9-6/h1-2,4H |
| InChIKey | ORIQLMBUPMABDV-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=CC=C1C#N |
| CAS DataBase Reference | 33252-28-7(CAS DataBase Reference) |
Description and Uses
6-Chloro-3-pyridinecarbonitrile (2-Chloro-5-cyanopyridine) may be used in the preparation of:
- (6-chloro-3-pyridyl)methylamine
- 2-(N-methyl-N-isopropylamino)-5-cyanopyridine
- S-(5-cyano-2-pyridyl)thiouronium chloride
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312-H315-H319-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P305+P351+P338 |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-36/37/39-37 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
