A2431212
2-Chloro-4-fluoro-5-nitrophenol , 98% , 84478-75-1
CAS NO.：84478-75-1
Empirical Formula: C6H3ClFNO3
Molecular Weight: 191.54
MDL number: MFCD02670258
EINECS: 671-719-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB92.00 | In Stock |
|
| 5G | RMB343.20 | In Stock |
|
| 25G | RMB1191.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105-108°C |
| Boiling point: | 298.7±40.0 °C(Predicted) |
| Density | 1.653±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Methanol[soluble in] |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 6.58±0.24(Predicted) |
| color | Light orange to Yellow to Green |
| InChI | InChI=1S/C6H3ClFNO3/c7-3-1-4(8)5(9(11)12)2-6(3)10/h1-2,10H |
| InChIKey | NAWVMCKMQMJQMF-UHFFFAOYSA-N |
| SMILES | C1(O)=CC([N+]([O-])=O)=C(F)C=C1Cl |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 2908990000 |
