A2389412
4-Chloro-2-nitrotoluene , 98% , 89-59-8
CAS NO.：89-59-8
Empirical Formula: C7H6ClNO2
Molecular Weight: 171.58
MDL number: MFCD00007215
EINECS: 201-921-2
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34-38 °C (lit.) |
| Boiling point: | 239-240 °C/718 mmHg (lit.) |
| Density | 1.2559 |
| refractive index | 1.5570 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Store below +30°C. |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow |
| Water Solubility | 109 mg/L (20 ºC) |
| BRN | 2046651 |
| InChI | InChI=1S/C7H6ClNO2/c1-5-2-3-6(8)4-7(5)9(10)11/h2-4H,1H3 |
| InChIKey | SQFLFRQWPBEDHM-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C(Cl)C=C1[N+]([O-])=O |
Description and Uses
4-Chloro-2-nitrotoluene can be used in the synthesis of indigo dye.
Safety
| Symbol(GHS) |     GHS07,GHS06,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H312-H331-H373-H401-H411 |
| Precautionary statements | P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501-P260-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn,N |
| Risk Statements | 36/37/38-20/21/22-52/53 |
| Safety Statements | 26-36-36/37/39-61 |
| RIDADR | UN 3457 6.1/PG 3 |
| WGK Germany | 2 |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
