A2370412
trans-1,4-Cyclohexanedicarboxylic acid , 97% , 619-82-9
CAS NO.：619-82-9
Empirical Formula: C8H12O4
Molecular Weight: 172.18
MDL number: MFCD00066203
EINECS: 210-614-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB27.20 | In Stock |
|
| 25G | RMB89.60 | In Stock |
|
| 100G | RMB268.80 | In Stock |
|
| 500g | RMB804.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Boiling point: | 262.49°C (rough estimate) |
| Density | 1.2104 (rough estimate) |
| refractive index | 1.4795 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | pK1:4.18 ;pK2:5.42 (16°C) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Soluble in hot methanol (almost transparency), ethanol, acetone. Slightly soluble in ether and water |
| InChI | InChI=1S/C8H12O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12)/t5-,6- |
| InChIKey | PXGZQGDTEZPERC-IZLXSQMJSA-N |
| SMILES | [C@@H]1(C(O)=O)CC[C@@H](C(O)=O)CC1 |
| CAS DataBase Reference | 619-82-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,4-Cyclohexanedicarboxylic acid, trans-(619-82-9) |
Description and Uses
It is a pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-24/25 |
| WGK Germany | 3 |
| HS Code | 29172090 |
