A2308612
2-Chloro-5-nitropyridine , 99% , 4548-45-2
CAS NO.：4548-45-2
Empirical Formula: C5H3ClN2O2
Molecular Weight: 158.54
MDL number: MFCD00006240
EINECS: 224-908-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB53.60 | In Stock |
|
| 100G | RMB163.20 | In Stock |
|
| 500g | RMB652.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105-108 °C (lit.) |
| Boiling point: | 256.6±20.0 °C(Predicted) |
| Density | 1.6616 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| Flash point: | 158°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | -4.22±0.10(Predicted) |
| form | Crystalline Powder |
| color | Light yellow to beige |
| Water Solubility | Solubility in hot methanol. Insoluble in water. |
| BRN | 120453 |
| InChI | InChI=1S/C5H3ClN2O2/c6-5-2-1-4(3-7-5)8(9)10/h1-3H |
| InChIKey | BAZVFQBTJPBRTJ-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C([N+]([O-])=O)C=C1 |
Description and Uses
2-Chloro-5-nitropyridine is used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | US7175000 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
