A2274912
3-Carboxyphenylboronic acid(contains varying amounts of Anhydride) , 99% , 25487-66-5
Synonym(s):
μ-Carboxyphenylboronic acid;3-(Dihydroxyborane)benzoic acid;3-(Dihydroxyboryl)benzoic acid;3-Boronobenzoic acid;3-Carboxybenzeneboronic acid
CAS NO.：25487-66-5
Empirical Formula: C7H7BO4
Molecular Weight: 165.94
MDL number: MFCD00036833
EINECS: 607-734-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB36.80 | In Stock |
|
| 25G | RMB87.20 | In Stock |
|
| 100G | RMB322.40 | In Stock |
|
| 500g | RMB1517.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 243-247 °C (lit.) |
| Boiling point: | 434.5±47.0 °C(Predicted) |
| Density | 1.40±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| pka | 4.21±0.10(Predicted) |
| form | Crystalline Powder |
| color | Off-white |
| Water Solubility | 2.5 g/100 mL |
| BRN | 2967400 |
| InChI | InChI=1S/C7H7BO4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4,11-12H,(H,9,10) |
| InChIKey | DBVFWZMQJQMJCB-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(B(O)O)=C1 |
| CAS DataBase Reference | 25487-66-5(CAS DataBase Reference) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H303-H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 37/39-26-36 |
| WGK Germany | 2 |
| RTECS | CY8750000 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Toxicity | mouse,LD50,intravenous,2560mg/kg (2560mg/kg),"Boron, Metallo-Boron Compounds and Boranes," Adams, R.M., ed., New York, John Wiley & Sons, Inc., 1964Vol. -, Pg. 693, 1964. |
