A2261012
5-Chlorothiophene-2-carboxylic , 98% , 24065-33-6
CAS NO.：24065-33-6
Empirical Formula: C5H3ClO2S
Molecular Weight: 162.59
MDL number: MFCD00041426
EINECS: 000-000-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB74.40 | In Stock |
|
| 100G | RMB218.40 | In Stock |
|
| 500g | RMB927.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154-158 °C(lit.) |
| Boiling point: | 287.0±20.0 °C(Predicted) |
| Density | 1.466 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 3.32±0.10(Predicted) |
| form | Powder |
| color | Cream-yellow |
| BRN | 118361 |
| InChI | InChI=1S/C5H3ClO2S/c6-4-2-1-3(9-4)5(7)8/h1-2H,(H,7,8) |
| InChIKey | QZLSBOVWPHXCLT-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)SC(Cl)=CC=1 |
Description and Uses
5-Chlorothiophene-2-carboxylic acid is a biochemical reagent that can be used as a biological material or organic compound for life science-related research. It is also used as a ligand to synthesise the New Mono and Binuclear Ruthenium(II) Complexes[1].
A metabolite of Rivaroxaban (R538000).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36-43-36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | XM8400000 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
