A2254212
1,4-Cyclohexanedicarboxylic acid , 99%. , 1076-97-7
Synonym(s):
1,4-CHDA-HP
CAS NO.：1076-97-7
Empirical Formula: C8H12O4
Molecular Weight: 172.18
MDL number: MFCD00001465
EINECS: 214-068-6
| Pack Size | Price | Stock | Quantity |
| 25G | RMB29.60 | In Stock |
|
| 100G | RMB80.80 | In Stock |
|
| 250g | RMB199.20 | In Stock |
|
| 500G | RMB300.80 | In Stock |
|
| 2.5kg | RMB1421.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 164-167 °C(lit.) |
| Boiling point: | 262.49°C (rough estimate) |
| Density | 1.2104 (rough estimate) |
| refractive index | 1.4450 (estimate) |
| Flash point: | 235°C |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.38±0.10(Predicted) |
| form | Powder |
| color | White to off-white |
| Water Solubility | SOLUBLE |
| BRN | 1870377 |
| InChI | InChI=1S/C8H12O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12) |
| InChIKey | PXGZQGDTEZPERC-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)CCC(C(O)=O)CC1 |
| CAS DataBase Reference | 1076-97-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,4-Cyclohexanedicarboxylic acid(1076-97-7) |
| EPA Substance Registry System | 1,4-Cyclohexanedicarboxylic acid (1076-97-7) |
Description and Uses
1,4-Cyclohexanedicarboxylic acid may be used in the synthesis of:
- polyesters
- polyamides
- poly(butylene adipate-co-butylene 1,4-cyclohexanedicarboxylate) copolyester
- various polyester polyols
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| RTECS | GU9060000 |
| TSCA | Yes |
| HS Code | 29172090 |
