A2039056
2-Bromo-4-chloro-1-iodobenzene , 98% , 31928-44-6
CAS NO.：31928-44-6
Empirical Formula: C6H3BrClI
Molecular Weight: 317.35
MDL number: MFCD00672944
EINECS: 608-682-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5g | RMB55.20 | In Stock |
|
| 25g | RMB167.20 | In Stock |
|
| 100g | RMB535.20 | In Stock |
|
| 500g | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 32-35℃ |
| Boiling point: | 279℃ |
| Density | 2.272 |
| Flash point: | 123℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Methanol[soluble in] |
| solubility | soluble in Methanol |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C6H3BrClI/c7-5-3-4(8)1-2-6(5)9/h1-3H |
| InChIKey | CXHXFDQEFKFYQJ-UHFFFAOYSA-N |
| SMILES | C1(I)=CC=C(Cl)C=C1Br |
| CAS DataBase Reference | 31928-44-6 |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37 |
| Hazard Note | Irritant |
| HS Code | 29039990 |
