1-<WBR>Boc-<WBR>3-<WBR>fluoro-<WBR>4-<WBR>oxopiperidine , 95% , 211108-50-8
Synonym(s):
tert-Butyl 3-fluoro-4-oxopiperidine-1-carboxylate;3-Fluoro-4-oxopiperidine-1-carboxylic acid tert-butyl ester
Pack Size | Price | Stock | Quantity |
250MG | RMB41.60 | In Stock |
|
1G | RMB94.40 | In Stock |
|
5g | RMB290.40 | In Stock |
|
others | Enquire |
PRODUCT Properties
Melting point: | 88-90℃ |
Boiling point: | 288.7±40.0 °C(Predicted) |
Density | 1.15±0.1 g/cm3(Predicted) |
storage temp. | Sealed in dry,Room Temperature |
form | powder to crystal |
pka | -3.61±0.40(Predicted) |
color | White to Light yellow |
InChI | InChI=1S/C10H16FNO3/c1-10(2,3)15-9(14)12-5-4-8(13)7(11)6-12/h7H,4-6H2,1-3H3 |
InChIKey | JZNWQLLPLOQGOI-UHFFFAOYSA-N |
SMILES | N1(C(OC(C)(C)C)=O)CCC(=O)C(F)C1 |
CAS DataBase Reference | 211108-50-8 |
Description and Uses
Tert-Butyl 3-Fluoro-4-Oxopiperidine-1-Carboxylate is a versatile compound that finds frequent application in chemical synthesis procedures. This compound serves as a valuable building block due to its unique structural properties and reactivity. Within the realm of organic synthesis, Tert-Butyl 3-Fluoro-4-Oxopiperidine-1-Carboxylate is commonly used as a key intermediate in the preparation of various pharmaceuticals, agrochemicals, and fine chemicals.
This compound undergoes a variety of selective reactions, enabling chemists to introduce functional groups at specific positions on the piperidine ring. Its tert-butyl ester group provides steric hindrance, influencing the compound's reactivity and selectivity in subsequent transformations. Additionally, the presence of a fluoro substituent enhances the compound's electronic properties, enabling it to participate in diverse synthetic strategies.Researchers leverage the unique structural features of Tert-Butyl 3-Fluoro-4-Oxopiperidine-1-Carboxylate to access complex molecular architectures efficiently. By incorporating this compound into their synthetic routes, chemists can streamline the synthesis of intricate molecules and accelerate the discovery of novel bioactive compounds. In summary, the versatile nature of Tert-Butyl 3-Fluoro-4-Oxopiperidine-1-Carboxylate makes it an indispensable tool in modern chemical synthesis endeavors.
Safety
Symbol(GHS) | ![]() GHS07 |
Signal word | Warning |
Hazard statements | H319 |
Precautionary statements | P305+P351+P338 |
Hazard Codes | Xi |
Risk Statements | 36-52 |
WGK Germany | 3 |
HazardClass | IRRITANT |
HS Code | 2933399990 |