A1626612
2,6-Bis(hydroxymethyl)-<i>p</i>-cresol , >98.0%(GC) , 91-04-3
CAS NO.：91-04-3
Empirical Formula: C9H12O3
Molecular Weight: 168.19
MDL number: MFCD00004619
EINECS: 202-036-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB48.00 | In Stock |
|
| 25G | RMB128.80 | In Stock |
|
| 100g | RMB480.80 | In Stock |
|
| 250G | RMB1191.20 | In Stock |
|
| 500g | RMB2319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128-130 °C(lit.) |
| Boiling point: | 237.12°C (rough estimate) |
| Density | 1.0812 (rough estimate) |
| vapor density | 5.8 (vs air) |
| refractive index | 1.4371 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | very faint turbidity in THF |
| form | powder to crystal |
| pka | 10.20±0.23(Predicted) |
| color | White to Yellow to Orange |
| BRN | 1240237 |
| InChI | InChI=1S/C9H12O3/c1-6-2-7(4-10)9(12)8(3-6)5-11/h2-3,10-12H,4-5H2,1H3 |
| InChIKey | KUMMBDBTERQYCG-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC(C)=CC(CO)=C1O |
| CAS DataBase Reference | 91-04-3(CAS DataBase Reference) |
| NIST Chemistry Reference | A1,a3-mesityllenediol, 2-hydroxy-(91-04-3) |
| EPA Substance Registry System | 1,3-Benzenedimethanol, 2-hydroxy-5-methyl- (91-04-3) |
Description and Uses
2,6-Bis(hydroxymethyl)-p-cresol was used as a bridging ligand in binuclear oxovanadium(V) compound, which on exposure to white light and aerial oxygen forms an oligomeric compound.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | CZ6440000 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HS Code | 29072990 |
