A1603612
Benzyl 2-Naphthyl Ether , >98.0% , 613-62-7
CAS NO.：613-62-7
Empirical Formula: C17H14O
Molecular Weight: 234.29
MDL number: MFCD00089092
EINECS: 405-490-3
| Pack Size | Price | Stock | Quantity |
| 25G | RMB132.00 | In Stock |
|
| 100g | RMB378.40 | In Stock |
|
| 2.5kg | RMB503.20 | In Stock |
|
| 500G | RMB1431.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 96-98°C |
| Boiling point: | 388.1±11.0 °C(Predicted) |
| Density | 1.125±0.06 g/cm3(Predicted) |
| vapor pressure | 0-0Pa at 20-25℃ |
| solubility | 5173.1 in mg/100g standard fat at 20 ℃ |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | 76-78μg/L at 20℃ |
| BRN | 2049922 |
| InChI | InChI=1S/C17H14O/c1-2-6-14(7-3-1)13-18-17-11-10-15-8-4-5-9-16(15)12-17/h1-12H,13H2 |
| InChIKey | WLTCCDHHWYAMCG-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC=C1OCC1=CC=CC=C1 |
| LogP | 4.46-5 at 20-21℃ |
| CAS DataBase Reference | 613-62-7(CAS DataBase Reference) |
