A1586912
4-(4-Butylphenylazo)phenol , 98% , 2496-21-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB39.20 | In Stock |
|
| 1g | RMB61.60 | In Stock |
|
| 5G | RMB221.60 | In Stock |
|
| 25G | RMB789.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80 °C |
| Boiling point: | 424.5±38.0 °C(Predicted) |
| Density | 1.06±0.1 g/cm3(Predicted) |
| solubility | soluble in Acetone |
| form | powder to crystal |
| pka | 8.92±0.15(Predicted) |
| color | Light yellow to Amber to Dark green |
| InChI | InChI=1S/C16H18N2O/c1-2-3-4-13-5-7-14(8-6-13)17-18-15-9-11-16(19)12-10-15/h5-12,19H,2-4H2,1H3 |
| InChIKey | FIWNTOUHYJJODB-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(N=NC2=CC=C(CCCC)C=C2)C=C1 |
Description and Uses
4-(4-Butylphenylazo)phenol interacts with certain biomolecules, allowing the binding and transport of these molecules in biological systems to be studied. Its unique chemical structure makes it a useful probe for studying the structure and function of biological macromolecules.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| HS Code | 2927.00.5000 |
