A1571512
1-Bromo-2,5-difluorobenzene , >98.0%(GC) , 399-94-0
CAS NO.：399-94-0
Empirical Formula: C6H3BrF2
Molecular Weight: 192.99
MDL number: MFCD00000345
EINECS: 206-920-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB56.00 | In Stock |
|
| 100G | RMB208.00 | In Stock |
|
| 500g | RMB872.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −31 °C(lit.) |
| Boiling point: | 58-59 °C20 mm Hg(lit.) |
| Density | 1.708 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 149 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.708 |
| Water Solubility | Insoluble |
| BRN | 1680893 |
| InChI | InChI=1S/C6H3BrF2/c7-5-3-4(8)1-2-6(5)9/h1-3H |
| InChIKey | XCRCSPKQEDMVBO-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(F)C=C1Br |
Description and Uses
2-Bromo-1,4-difluorobenzene has been used in the preparation of 1,4-difluoroanthraquinone, a precursor to ametantrone.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,F,Xn |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-2637/39-37/39 |
| RIDADR | UN 2922 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HazardClass | IRRITANT, FLAMMABLE |
| HS Code | 29039990 |
