A1537112
4-Bromo-2-methylbenzoic Acid , >98.0%(HPLC) , 68837-59-2
CAS NO.：68837-59-2
Empirical Formula: C8H7BrO2
Molecular Weight: 215.04
MDL number: MFCD00040905
EINECS: 272-437-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB36.00 | In Stock |
|
| 25G | RMB127.20 | In Stock |
|
| 100G | RMB463.20 | In Stock |
|
| 500g | RMB2159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180-184 °C |
| Boiling point: | 310.1±30.0 °C(Predicted) |
| Density | 1.599±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 3.63±0.25(Predicted) |
| color | White to Almost white |
| Water Solubility | Insoluble in water. |
| BRN | 2249816 |
| InChI | InChI=1S/C8H7BrO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
| InChIKey | RVCJOGNLYVNRDN-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Br)C=C1C |
| CAS DataBase Reference | 68837-59-2(CAS DataBase Reference) |
Description and Uses
A building block which is used in preparation of anthranilic acids possessing antibacterial activity. 4-bromo-2-methylbenzoic acid could be used to synthesis 4-chloro-3'-(2-cyclopentyl-1-oxoisoindolin-5-yl)biphenyl-3-carboxylic acid through Suzuki couplings[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37/39-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29163990 |
