A1459712
1-Bromo-3,4-difluorobenzene , ≥98.0%(GC) , 348-61-8
CAS NO.：348-61-8
Empirical Formula: C6H3BrF2
Molecular Weight: 192.99
MDL number: MFCD00000304
EINECS: 206-481-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.80 | In Stock |
|
| 25G | RMB38.40 | In Stock |
|
| 100G | RMB132.80 | In Stock |
|
| 250G | RMB2079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -4 °C |
| Boiling point: | 150-151 °C(lit.) |
| Density | 1.707 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 92 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| Specific Gravity | 1.707 |
| color | Clear colorless to pale yellow |
| Water Solubility | insoluble |
| BRN | 1934811 |
| InChI | InChI=1S/C6H3BrF2/c7-4-1-2-5(8)6(9)3-4/h1-3H |
| InChIKey | YMQPKONILWWJQG-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(Br)C=C1F |
Description and Uses
4-Bromo-1,2-difluorobenzene has been used in the preparation of 4-benzyl-2-(3,4-difluorophenyl)-2-hydroxy-morpholine.
Safety
| Symbol(GHS) |    GHS02,GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H226-H302+H332-H315-H317-H411 |
| Precautionary statements | P210-P273-P280-P301+P312-P303+P361+P353-P304+P340+P312 |
| Hazard Codes | Xi,F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36/37/39-37/39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 2 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
