A1450012
3-(4-bromophenyl)propan-1-ol , 98% , 25574-11-2
CAS NO.：25574-11-2
Empirical Formula: C9H11BrO
Molecular Weight: 215.09
MDL number: MFCD09028724
EINECS: 634-788-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB99.20 | In Stock |
|
| 25g | RMB444.80 | In Stock |
|
| 100g | RMB1680.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 162℃/2.5Torr |
| Density | 1.41 |
| refractive index | 1.5620 to 1.5660 |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 15.03±0.10(Predicted) |
| form | Solid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C9H11BrO/c10-9-5-3-8(4-6-9)2-1-7-11/h3-6,11H,1-2,7H2 |
| InChIKey | WODKXGCVVOOEIJ-UHFFFAOYSA-N |
| SMILES | C1(CCCO)=CC=C(Br)C=C1 |
Description and Uses
3-(4-Bromophenyl)Propan-1-ol is a useful reagent in the synthesis of dimethylmorpholine substituted daphneolone derivatives with fungicidal properties.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HazardClass | IRRITANT |
| HS Code | 29062990 |
