A1403912
5-Bromoindole-2-carboxylic Acid Ethyl Ester , ≥98.0% , 16732-70-0
Synonym(s):
5-Bromoindole-2-carboxylic acid ethyl ester
CAS NO.：16732-70-0
Empirical Formula: C11H10BrNO2
Molecular Weight: 268.11
MDL number: MFCD00022701
EINECS: 680-051-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.00 | In Stock |
|
| 5G | RMB120.80 | In Stock |
|
| 25G | RMB516.80 | In Stock |
|
| 100G | RMB1344.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165 °C |
| Boiling point: | 394.7±22.0 °C(Predicted) |
| Density | 1.554±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Acetone |
| pka | 14.05±0.30(Predicted) |
| form | Solid |
| color | White to Orange to Green |
| InChI | InChI=1S/C11H10BrNO2/c1-2-15-11(14)10-6-7-5-8(12)3-4-9(7)13-10/h3-6,13H,2H2,1H3 |
| InChIKey | LWRLKENDQISGEU-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Br)C=C2)C=C1C(OCC)=O |
Description and Uses
Ethyl 5-Bromoindole-2-carboxylate is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
