A1389312
1-Bromo-4-(trifluoromethoxy)benzene , ≥98.0% , 407-14-7
Synonym(s):
1-Bromo-4-(trifluoromethoxy)benzene;p-Trifluoromethoxy bromo benzene
CAS NO.：407-14-7
Empirical Formula: C7H4BrF3O
Molecular Weight: 241.01
MDL number: MFCD00040834
EINECS: 206-979-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB28.80 | In Stock |
|
| 100G | RMB100.00 | In Stock |
|
| 500g | RMB436.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 80 °C50 mm Hg(lit.) |
| Density | 1.622 g/mL at 25 °C(lit.) |
| vapor pressure | 20 hPa (55 °C) |
| refractive index | n |
| Flash point: | 154 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 11.7mg/l |
| form | Liquid |
| Specific Gravity | 1.64 |
| color | Clear colorless to yellow |
| BRN | 2046332 |
| InChI | InChI=1S/C7H4BrF3O/c8-5-1-3-6(4-2-5)12-7(9,10)11/h1-4H |
| InChIKey | SEAOBYFQWJFORM-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(OC(F)(F)F)C=C1 |
| CAS DataBase Reference | 407-14-7(CAS DataBase Reference) |
| NIST Chemistry Reference | P-bromophenyl trifluoromethyl ether(407-14-7) |
Description and Uses
1-Bromo-4-(trifluoromethoxy)benzene was used in the synthesis of 4-{[4-[(2-ethylhexyloxy)-6-(4-morpholinylmethyl)-4-trifluoromethyl][1,1-biphenyl]-3-yl]methyl}morpholine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 |
| Precautionary statements | P264-P280-P302+P352-P332+P313-P362+P364 |
| Hazard Codes | Xn,N,Xi |
| Risk Statements | 22-36/37/38-43-51/53 |
| Safety Statements | 26-36/37-61-37/39-36 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 1 |
| HazardClass | IRRITANT |
| HS Code | 29093090 |
| Toxicity | LD50 orally in Rabbit: > 2500 mg/kg |
