A1385112
5-Bromo-2-methylpyridine , ≥98.0%(GC) , 3430-13-5
Synonym(s):
5-Bromo-2-picoline
CAS NO.：3430-13-5
Empirical Formula: C6H6BrN
Molecular Weight: 172.02
MDL number: MFCD00661170
EINECS: 625-656-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB52.00 | In Stock |
|
| 25G | RMB172.00 | In Stock |
|
| 100G | RMB419.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 32-36 °C |
| Boiling point: | 74 °C / 17mmHg |
| Density | 1.494±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| pka | 3.59±0.10(Predicted) |
| color | Off-White to Light Yellow |
| BRN | 107324 |
| InChI | InChI=1S/C6H6BrN/c1-5-2-3-6(7)4-8-5/h2-4H,1H3 |
| InChIKey | OFKWIQJLYCKDNY-UHFFFAOYSA-N |
| SMILES | C1(C)=NC=C(Br)C=C1 |
Description and Uses
5-Bromo-2-picoline is a halogenated pyridine derivative used is a building block in the preparation of nitrogen containing heterocyclic compounds.
Safety
| Symbol(GHS) |   GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H301-H311-H332 |
| Precautionary statements | P261-P305+P351+P338-P301+P310a-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
