A1374812
4-tert-Butylbenzyl bromide , 97% , 18880-00-7
Synonym(s):
α-Bromo-4-(tert-butyl)toluene;1-Bromomethyl-4-tert-butylbenzene
CAS NO.：18880-00-7
Empirical Formula: C11H15Br
Molecular Weight: 227.14
MDL number: MFCD00000180
EINECS: 242-643-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB66.40 | In Stock |
|
| 25G | RMB166.40 | In Stock |
|
| 100G | RMB487.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 8-12 °C (lit.) |
| Boiling point: | 93-94 °C/1.5 mmHg (lit.) |
| Density | 1.236 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| color | Clear light yellow |
| Specific Gravity | 1.236 |
| BRN | 471674 |
| InChI | InChI=1S/C11H15Br/c1-11(2,3)10-6-4-9(8-12)5-7-10/h4-7H,8H2,1-3H3 |
| InChIKey | QZNQSIHCDAGZIA-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=C(C(C)(C)C)C=C1 |
| CAS DataBase Reference | 18880-00-7(CAS DataBase Reference) |
| NIST Chemistry Reference | p-tert-Butylbenzyl bromide(18880-00-7) |
Description and Uses
4-tert-Butylbenzyl bromide, a hydrophobic reactant, was used to keep the loaded mesoporous material particles under continuous stirring.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| Hazard Codes | C,Xi |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 19 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29036990 |
