A1370012
4-Bromo-1-methyl-1H-pyrazole , 98% , 15803-02-8
Synonym(s):
1-Methyl-4-bromopyrazole
CAS NO.：15803-02-8
Empirical Formula: C4H5BrN2
Molecular Weight: 161
MDL number: MFCD02179565
EINECS: 605-126-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB57.60 | In Stock |
|
| 100G | RMB176.00 | In Stock |
|
| 500g | RMB848.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 185-188°C |
| Density | 1.558 |
| refractive index | n20/D 1.531 |
| Flash point: | 93°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| pka | 0.21±0.10(Predicted) |
| color | Colorless to pale yellow |
| InChI | InChI=1S/C4H5BrN2/c1-7-3-4(5)2-6-7/h2-3H,1H3 |
| InChIKey | IXJSDKIJPVSPKF-UHFFFAOYSA-N |
| SMILES | N1(C)C=C(Br)C=N1 |
Description and Uses
4-Bromo-1-methylpyrazole is a colourless or light yellow liquid at room temperature and pressure. It can be used as an intermediate in organic synthesis. It has good solubility in common organic solvents such as ethyl acetate, dichloromethane, dimethyl sulfoxide, and N, N-dimethylformamide but poor solubility in water.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-39 |
| RIDADR | UN1760 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29331990 |
