A1362912
N-Boc- 2,2′-(ethylenedioxy)diethylamine , ≥97.0%(HPLC) , 153086-78-3
Synonym(s):
N-Boc-3,6-dioxa-1,8-octanediamine;tert-Butyl 2-[2-(2-aminoethoxy)ethoxy]ethylcarbamate
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB100.80 | In Stock |
|
| 1G | RMB138.40 | In Stock |
|
| 5G | RMB557.60 | In Stock |
|
| 25g | RMB2239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 365.2±27.0 °C(Predicted) |
| Density | 1.046 g/mL at 20 °C |
| refractive index | 1.4570 to 1.4610 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 12.23±0.46(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C11H24N2O4/c1-11(2,3)17-10(14)13-5-7-16-9-8-15-6-4-12/h4-9,12H2,1-3H3,(H,13,14) |
| InChIKey | OCUICOFGFQENAS-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)NCCOCCOCCN |
Description and Uses
t-Boc-N-Amido-PEG2-amine is a PEG linker containing an amino group and Boc-protected amino group. The hydrophilic PEG spacer increases solubility in aqueous media. The amino group is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The Boc group can be deprotected under mild acidic conditions to form the free amine.
Linker reagent for the prep. of a broad variety of linked tags, monomers for polymerisation, ionophores etc., e.g. biotinylation reagents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 2735 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | Ⅲ |
| HS Code | 29241990 |
