A1344112
4-Bromo-3-fluorophenol , 98% , 121219-03-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB39.20 | In Stock |
|
| 5G | RMB80.80 | In Stock |
|
| 25G | RMB332.00 | In Stock |
|
| 100G | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 71.5 °C |
| Boiling point: | 75°C/1mm |
| Density | 1.764±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 8.40±0.18(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C6H4BrFO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H |
| InChIKey | MRQYTJXVULSNIS-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(Br)C(F)=C1 |
| CAS DataBase Reference | 121219-03-2(CAS DataBase Reference) |
Description and Uses
3-Fluoro-4-bromophenol is a phenolic organic compound, which can be used as a fluorine-containing organic intermediate, and can be used for the synthesis of medicines, pesticides, dyes, etc.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-41-22 |
| Safety Statements | 26-36/37/39-39 |
| HazardClass | IRRITANT |
| HS Code | 29081990 |
