A1340812
3′,5′-Bis(trifluoromethyl)acetophenone , 98% , 30071-93-3
CAS NO.：30071-93-3
Empirical Formula: C10H6F6O
Molecular Weight: 256.14
MDL number: MFCD00009910
EINECS: 250-023-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB71.20 | In Stock |
|
| 100G | RMB231.20 | In Stock |
|
| 500G | RMB1011.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 95-98 °C (15 mmHg) |
| Density | 1.422 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 180 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 1.422 |
| BRN | 2384789 |
| InChI | InChI=1S/C10H6F6O/c1-5(17)6-2-7(9(11,12)13)4-8(3-6)10(14,15)16/h2-4H,1H3 |
| InChIKey | MCYCSIKSZLARBD-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1)C |
Description and Uses
3'',5''-Bis(Trifluoromethyl)acetophenone is a reactant that has been used in the preparation of pyrazole carboxamide derivatives with antibacterial and antifungal activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37/39-36 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
