5-Bromo-2-chlorobenzoic acid , 98% , 21739-92-4
CAS NO.：21739-92-4
Empirical Formula: C7H4BrClO2
Molecular Weight: 235.46
MDL number: MFCD00002415
EINECS: 244-558-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB28.00 | In Stock |
|
| 25G | RMB40.00 | In Stock |
|
| 100G | RMB116.80 | In Stock |
|
| 500G | RMB517.60 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 154-156 °C (lit.) |
| Boiling point: | 324.5±27.0 °C(Predicted) |
| Density | 1.7312 (rough estimate) |
| refractive index | 1.5590 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 2.63g/l |
| pka | 2.49±0.25(Predicted) |
| form | Solid |
| color | Off white colored powder |
| Water Solubility | Soluble in water 2.63 g/L @20°C. |
| BRN | 2691432 |
| InChI | InChI=1S/C7H4BrClO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11) |
| InChIKey | FGERXQWKKIVFQG-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Br)=CC=C1Cl |
Description and Uses
5-Bromo-2-chlorobenzoic acid (BCBA) is an organic reagent that can be used in electroinduced dehalogenation reactions. Ag/Cu electrodes exhibit high electrocatalytic activity in the dehalogenation reaction of BCBA. The process is characterised by a sequence of halide excretion and hydrogen addition. Since the bond dissociation energy value of C-Br bond is smaller than that of C-Cl bond, Br-w is more easily released from the benzene ring. As C-Br breaks, BCBA gains electrons and hydrogen to form the intermediate 2-chlorobenzoate. C-Cl then breaks in the same way to give the final product benzoate.
5-Bromo-2-chlorobenzoic acid was used to evaluate the homogeneity of organic powder. It can be used to produce 2-chloro-5-deuteriobenzoic acid.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163900 |
