A1335350
(S)-2-(Dimethylamino)-3-phenylpropanoicacid , ≥95% , 17469-89-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB69.60 | In Stock |
|
| 1g | RMB168.80 | In Stock |
|
| 5g | RMB607.20 | In Stock |
|
| 25g | RMB1825.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 225-227 °C(lit.) |
| Boiling point: | 308.1±35.0 °C(Predicted) |
| Density | 1?+-.0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 2.24±0.11(Predicted) |
| form | Powder |
| color | White to off-white |
| optical activity | [α]20/D +77°, c = 1.3 in H2O |
| BRN | 2966581 |
| InChI | InChI=1S/C11H15NO2/c1-12(2)10(11(13)14)8-9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | HOGIQTACRLIOHC-JTQLQIEISA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=CC=C1)N(C)C |
Description and Uses
N,N-Dimethyl-L-phenylalanine is commonly used to prepare Cu(II)-L-amino acid complex, which is a chiral mobile phase additive for the resolution of enantiomers. It can also be used in the total synthesis of (?)-paliurine E and almazole D.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
