A1322112
N-Boc-piperidine-4-carbonitrile , 97% , 91419-52-2
Synonym(s):
1,1-Dimethylethyl 4-cyano-1-piperidinecarboxylate;1-Boc-4-cyanopiperidine;4-Cyano-1-piperidinecarboxylic acid 1,1-dimethylethyl ester
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB18.40 | In Stock |
|
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB51.20 | In Stock |
|
| 25G | RMB155.20 | In Stock |
|
| 100g | RMB608.00 | In Stock |
|
| 500g | RMB2592.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-63 °C |
| Boiling point: | 325.3±35.0 °C(Predicted) |
| Density | 1.07±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform |
| pka | -3.08±0.40(Predicted) |
| form | Crystalline Powder |
| color | White to off-white |
| InChI | InChI=1S/C11H18N2O2/c1-11(2,3)15-10(14)13-6-4-9(8-12)5-7-13/h9H,4-7H2,1-3H3 |
| InChIKey | UQADQTBQNVARAP-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(C#N)CC1 |
Description and Uses
Reactant for synthesis of:
- Aminomethylated fluoropiperidines
- Protein kinase B inhibitors
- GlyT1 inhibitors
- Piperidinecarboxylic acids via nitrilase-catalyzed enantioselective synthesis
Reactant for
- Replacement in CB2 receptor inhibitors
- Double addition reactions of methyllithium and n-butyllithium to unsaturated nitriles
Safety
| Symbol(GHS) |    GHS09,GHS06,GHS07 |
| Signal word | Warning |
| Hazard statements | H312-H331-H301+H311+H331-H315-H302-H319-H400 |
| Precautionary statements | P273-P305+P351+P338-P261-P264-P270-P271-P280-P301+P310+P330-P302+P352+P312+P361+P364-P304+P340+P311-P305+P351+P338+P337+P313-P403+P233-P405-P501-P280h-P304+P340-P311a-P501a |
| Hazard Codes | Xn,N |
| Risk Statements | 20/21/22-50-36-22 |
| Safety Statements | 36-36/37/39-61-26 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
