A1294712
N-Benzyltropinone , 95% , 28957-72-4
CAS NO.：28957-72-4
Empirical Formula: C14H17NO
Molecular Weight: 215.29
MDL number: MFCD00151640
EINECS: 249-329-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB69.60 | In Stock |
|
| 5G | RMB176.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 28-29°C |
| Boiling point: | 134-137°C/0.4 mm |
| Density | 1.140±0.06 g/cm3(Predicted) |
| refractive index | 1.556 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Dichloromethane, Methanol |
| form | Solid |
| pka | 7.98±0.20(Predicted) |
| color | Off-White to Pale Yellow |
| InChI | InChI=1S/C14H17NO/c16-14-8-12-6-7-13(9-14)15(12)10-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2 |
| InChIKey | RSUHKGOVXMXCND-UHFFFAOYSA-N |
| SMILES | C12N(CC3=CC=CC=C3)C(CC1)CC(=O)C2 |
| CAS DataBase Reference | 28957-72-4(CAS DataBase Reference) |
Description and Uses
An intermediate for the preparation of β-Cocaine, opioid receptor antagonists, and CCR-5 receptor antagonists
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 23-26-36/37/39-45 |
| RIDADR | UN1760 |
| HS Code | 29299090 |
