A1262512
Bis(benzonitrile)palladium(II) chloride , 98% , 14220-64-5
Synonym(s):
Bis(benzonitrile)palladium(II) chloride;Bis(benzonitrile)dichloropalladium(II);Dichlorobis(benzonitrile)palladium;Dichlorobis(benzonitrile)palladium(II);Dichlorobis(phenyl cyanide)palladium
CAS NO.：14220-64-5
Empirical Formula: C14H10Cl2N2Pd
Molecular Weight: 383.57
MDL number: MFCD00013123
EINECS: 238-085-3
| Pack Size | Price | Stock | Quantity |
| 500MG | RMB239.20 | In Stock |
|
| 1G | RMB399.20 | In Stock |
|
| 5G | RMB2239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 131 °C(lit.) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Soluble in acetone, chloroform |
| form | Crystalline Powder |
| color | Orange to brown |
| Water Solubility | insoluble |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 3981730 |
| Exposure limits | NIOSH: IDLH 25 mg/m3 |
| InChI | InChI=1S/2C7H5N.2ClH.Pd/c2*8-6-7-4-2-1-3-5-7;;;/h2*1-5H;2*1H;/q;;;;+2/p-2 |
| InChIKey | WXNOJTUTEXAZLD-UHFFFAOYSA-L |
| SMILES | C1(C#N)=CC=CC=C1.C1(C#N)=CC=CC=C1.[Pd](Cl)Cl |
Description and Uses
Catalyst for greener amine synthesis from terminal olefins by Wacker oxidation followed by transfer hydrogenation of the resultant imine.
Safety
| Symbol(GHS) |   GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319-H302-H312-H332 |
| Precautionary statements | P280h-P301+P312a-P304+P340-P321-P501a-P261-P264-P270-P271-P280-P301+P310+P330-P302+P352+P312+P361+P364-P304+P340+P311-P305+P351+P338+P337+P313-P403+P233-P405-P501 |
| Hazard Codes | Xn |
| Risk Statements | 20/21-23/24/25 |
| Safety Statements | 22-24/25-23-45-36/37-27-20-9-4 |
| RIDADR | UN3439 |
| WGK Germany | 3 |
| F | 9 |
| TSCA | No |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 28439090 |
