A1256450
Ethyl3-methyl-2-oxobutyrate , 97% , 20201-24-5
Synonym(s):
Ethyl dimethylpyruvate;Ketovaline ethyl ester
CAS NO.：20201-24-5
Empirical Formula: C7H12O3
Molecular Weight: 144.17
MDL number: MFCD00009122
EINECS: 243-587-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB146.40 | In Stock |
|
| 5g | RMB415.20 | In Stock |
|
| 25g | RMB1839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 62 °C/11 mmHg (lit.) |
| Density | 0.989 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 110 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Clear light yellow |
| Water Solubility | Slightly soluble in water. |
| BRN | 1756668 |
| InChI | InChI=1S/C7H12O3/c1-4-10-7(9)6(8)5(2)3/h5H,4H2,1-3H3 |
| InChIKey | CKTYYUQUWFEUCO-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(=O)C(C)C |
Description and Uses
Ethyl dimethylpyruvate is used as an allyl halide reactant in the presence of indium to release hydroxy unsaturated carbonyl compounds. It was also used in the synthesis of (2SR,4SR)-5(S)-(N-Boc)-amino-6-cyclohexyl-4-hydoxy-2-isopropyl hexanoic acid.
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210-P233-P240-P241-P242-P243 |
| Risk Statements | 10 |
| Safety Statements | 16 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29183000 |
