A1255712
BOC-L-Hydroxyproline methyl ester , 98% , 74844-91-0
CAS NO.：74844-91-0
Empirical Formula: C11H19NO5
Molecular Weight: 245.27
MDL number: MFCD00076981
EINECS: 616-143-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB25.60 | In Stock |
|
| 25G | RMB51.20 | In Stock |
|
| 100G | RMB144.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-96 °C (lit.) |
| alpha | -65 º (c=1 CHCl3) |
| Boiling point: | 132°C/0.05mmHg(lit.) |
| Density | 1.216±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in chloroform, dichloromethane and ethyl acetate. |
| pka | 14.27±0.40(Predicted) |
| form | Crystalline Powder |
| color | White to light beige |
| optical activity | [α]20/D -65°, c = 1% in chloroform |
| InChI | InChI=1S/C11H19NO5/c1-11(2,3)17-10(15)12-6-7(13)5-8(12)9(14)16-4/h7-8,13H,5-6H2,1-4H3/t7-,8+/m1/s1 |
| InChIKey | MZMNEDXVUJLQAF-SFYZADRCSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)C[C@H](O)C[C@H]1C(OC)=O |
| LogP | 0.813 at 25℃ |
Description and Uses
It is used in the synthesis of For-Met-Leu-Phe-OMe (fMLF-OMe) analogues based on Met residue replacement by 4-amino-proline scaffold.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P301+P330+P331-P304+P340+P310-P305+P351+P338+P310 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
